C14H20ClNO3S2 — CID 65019612
5-[(cyclooctanecarbonylamino)methyl]thiophene-2-sulfonyl chloride (PubChem CID 65019612) has the molecular formula C14H20ClNO3S2 and a molecular weight of 349.91 g/mol. Its IUPAC name is 5-[(cyclooctanecarbonylamino)methyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[(cyclooctanecarbonylamino)methyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 65019612 |
| Molecular Formula | C14H20ClNO3S2 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 5-[(cyclooctanecarbonylamino)methyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(NCc1ccc(S(=O)(=O)Cl)s1)C1CCCCCCC1 |
| InChI | InChI=1S/C14H20ClNO3S2/c15-21(18,19)13-9-8-12(20-13)10-16-14(17)11-6-4-2-1-3-5-7-11/h8-9,11H,1-7,10H2,(H,16,17) |
| InChIKey | AOUKCRMUJDEYDJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |