C10H12ClNO3S2 — CID 24689033
5-[2-(cyclopropanecarbonylamino)ethyl]thiophene-2-sulfonyl chloride (PubChem CID 24689033) has the molecular formula C10H12ClNO3S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is 5-[2-(cyclopropanecarbonylamino)ethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-(cyclopropanecarbonylamino)ethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 24689033 |
| Molecular Formula | C10H12ClNO3S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 5-[2-(cyclopropanecarbonylamino)ethyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)Cl)s1)C1CC1 |
| InChI | InChI=1S/C10H12ClNO3S2/c11-17(14,15)9-4-3-8(16-9)5-6-12-10(13)7-1-2-7/h3-4,7H,1-2,5-6H2,(H,12,13) |
| InChIKey | QXTALZKCUCMVAJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |