C13H18ClNO4S2 — CID 65157400
5-[2-[3-(oxolan-2-yl)propanoylamino]ethyl]thiophene-2-sulfonyl chloride (PubChem CID 65157400) has the molecular formula C13H18ClNO4S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 5-[2-[3-(oxolan-2-yl)propanoylamino]ethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-[3-(oxolan-2-yl)propanoylamino]ethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 65157400 |
| Molecular Formula | C13H18ClNO4S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 5-[2-[3-(oxolan-2-yl)propanoylamino]ethyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(CCC1CCCO1)NCCc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C13H18ClNO4S2/c14-21(17,18)13-6-4-11(20-13)7-8-15-12(16)5-3-10-2-1-9-19-10/h4,6,10H,1-3,5,7-9H2,(H,15,16) |
| InChIKey | ADGDHMBRQFPCCU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |