C12H16ClNO4S2 — CID 65157446
5-[1-[[2-(oxolan-2-yl)acetyl]amino]ethyl]thiophene-2-sulfonyl chloride (PubChem CID 65157446) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 5-[1-[[2-(oxolan-2-yl)acetyl]amino]ethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[1-[[2-(oxolan-2-yl)acetyl]amino]ethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 65157446 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 5-[1-[[2-(oxolan-2-yl)acetyl]amino]ethyl]thiophene-2-sulfonyl chloride |
| SMILES | CC(NC(=O)CC1CCCO1)c1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C12H16ClNO4S2/c1-8(10-4-5-12(19-10)20(13,16)17)14-11(15)7-9-3-2-6-18-9/h4-5,8-9H,2-3,6-7H2,1H3,(H,14,15) |
| InChIKey | AXHODGOUTPIYNB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |