C10H10ClN3O3S2 — CID 63086454
5-[2-(1H-pyrazole-5-carbonylamino)ethyl]thiophene-2-sulfonyl chloride (PubChem CID 63086454) has the molecular formula C10H10ClN3O3S2 and a molecular weight of 319.80 g/mol. Its IUPAC name is 5-[2-(1H-pyrazole-5-carbonylamino)ethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-(1H-pyrazole-5-carbonylamino)ethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 63086454 |
| Molecular Formula | C10H10ClN3O3S2 |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 5-[2-(1H-pyrazole-5-carbonylamino)ethyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)Cl)s1)c1ccn[nH]1 |
| InChI | InChI=1S/C10H10ClN3O3S2/c11-19(16,17)9-2-1-7(18-9)3-5-12-10(15)8-4-6-13-14-8/h1-2,4,6H,3,5H2,(H,12,15)(H,13,14) |
| InChIKey | QCVWQJUONRZUMG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |