C12H12BrN3O3S2 — CID 107519551
3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-2-carboxamide (PubChem CID 107519551) has the molecular formula C12H12BrN3O3S2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107519551 |
| Molecular Formula | C12H12BrN3O3S2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | 3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ncccc2Br)s1 |
| InChI | InChI=1S/C12H12BrN3O3S2/c13-9-2-1-6-15-11(9)12(17)16-7-5-8-3-4-10(20-8)21(14,18)19/h1-4,6H,5,7H2,(H,16,17)(H2,14,18,19) |
| InChIKey | HRVAOFMJULWPFE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |