C12H14N2O4S2 — CID 114822706
5-methyl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]furan-3-carboxamide (PubChem CID 114822706) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-methyl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]furan-3-carboxamide.
| Compound Name | 5-methyl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 114822706 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-methyl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCc2ccc(S(N)(=O)=O)s2)co1 |
| InChI | InChI=1S/C12H14N2O4S2/c1-8-6-9(7-18-8)12(15)14-5-4-10-2-3-11(19-10)20(13,16)17/h2-3,6-7H,4-5H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | WVESPJSJWJXOIJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |