C13H14N2O3S2 — CID 43246441
N-[2-(5-sulfamoylthiophen-2-yl)ethyl]benzamide (PubChem CID 43246441) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[2-(5-sulfamoylthiophen-2-yl)ethyl]benzamide.
| Compound Name | N-[2-(5-sulfamoylthiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 43246441 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-[2-(5-sulfamoylthiophen-2-yl)ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C13H14N2O3S2/c14-20(17,18)12-7-6-11(19-12)8-9-15-13(16)10-4-2-1-3-5-10/h1-7H,8-9H2,(H,15,16)(H2,14,17,18) |
| InChIKey | DCBMDRARMSXVGQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |