C11H11BrN2O3S3 — CID 47286704
3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 47286704) has the molecular formula C11H11BrN2O3S3 and a molecular weight of 395.33 g/mol. Its IUPAC name is 3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47286704 |
| Molecular Formula | C11H11BrN2O3S3 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 393.91 |
| IUPAC Name | 3-bromo-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2sccc2Br)s1 |
| InChI | InChI=1S/C11H11BrN2O3S3/c12-8-4-6-18-10(8)11(15)14-5-3-7-1-2-9(19-7)20(13,16)17/h1-2,4,6H,3,5H2,(H,14,15)(H2,13,16,17) |
| InChIKey | CJYADCCOUPTIMO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |