C8H10BrNOS — CID 58831720
3-bromo-N-propylthiophene-2-carboxamide (PubChem CID 58831720) has the molecular formula C8H10BrNOS and a molecular weight of 248.14 g/mol. Its IUPAC name is 3-bromo-N-propylthiophene-2-carboxamide.
| Compound Name | 3-bromo-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 58831720 |
| Molecular Formula | C8H10BrNOS |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 3-bromo-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sccc1Br |
| InChI | InChI=1S/C8H10BrNOS/c1-2-4-10-8(11)7-6(9)3-5-12-7/h3,5H,2,4H2,1H3,(H,10,11) |
| InChIKey | RVAMEMQMIYPLGW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |