C8H7BrF3NOS — CID 63801472
3-bromo-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide (PubChem CID 63801472) has the molecular formula C8H7BrF3NOS and a molecular weight of 302.12 g/mol. Its IUPAC name is 3-bromo-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63801472 |
| Molecular Formula | C8H7BrF3NOS |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.94 |
| IUPAC Name | 3-bromo-N-(3,3,3-trifluoropropyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCC(F)(F)F)c1sccc1Br |
| InChI | InChI=1S/C8H7BrF3NOS/c9-5-1-4-15-6(5)7(14)13-3-2-8(10,11)12/h1,4H,2-3H2,(H,13,14) |
| InChIKey | DBLIUBCYHWGJTF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |