C13H9BrF3NOS — CID 60778137
3-bromo-N-[[2-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 60778137) has the molecular formula C13H9BrF3NOS and a molecular weight of 364.19 g/mol. Its IUPAC name is 3-bromo-N-[[2-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[[2-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 60778137 |
| Molecular Formula | C13H9BrF3NOS |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 3-bromo-N-[[2-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1C(F)(F)F)c1sccc1Br |
| InChI | InChI=1S/C13H9BrF3NOS/c14-10-5-6-20-11(10)12(19)18-7-8-3-1-2-4-9(8)13(15,16)17/h1-6H,7H2,(H,18,19) |
| InChIKey | IMBOKHGULCLWFZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |