C9H9BrF3NOS — CID 79039212
3-bromo-N-(4,4,4-trifluorobutyl)thiophene-2-carboxamide (PubChem CID 79039212) has the molecular formula C9H9BrF3NOS and a molecular weight of 316.14 g/mol. Its IUPAC name is 3-bromo-N-(4,4,4-trifluorobutyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(4,4,4-trifluorobutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79039212 |
| Molecular Formula | C9H9BrF3NOS |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 3-bromo-N-(4,4,4-trifluorobutyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)c1sccc1Br |
| InChI | InChI=1S/C9H9BrF3NOS/c10-6-2-5-16-7(6)8(15)14-4-1-3-9(11,12)13/h2,5H,1,3-4H2,(H,14,15) |
| InChIKey | QLDPCSYXCBBHQP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|