C13H14F3NO3S — CID 115521958
(E)-3-[2-(5,5,5-trifluoropentylcarbamoyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 115521958) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is (E)-3-[2-(5,5,5-trifluoropentylcarbamoyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(5,5,5-trifluoropentylcarbamoyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115521958 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (E)-3-[2-(5,5,5-trifluoropentylcarbamoyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccsc1C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3S/c14-13(15,16)6-1-2-7-17-12(20)11-9(5-8-21-11)3-4-10(18)19/h3-5,8H,1-2,6-7H2,(H,17,20)(H,18,19)/b4-3+ |
| InChIKey | TZKOUISIERTAHB-ONEGZZNKSA-N |
| XLogP | 3.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|