C13H17NO4S — CID 104765280
(E)-3-[2-[(2-methoxy-2-methylpropyl)carbamoyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 104765280) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is (E)-3-[2-[(2-methoxy-2-methylpropyl)carbamoyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(2-methoxy-2-methylpropyl)carbamoyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104765280 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (E)-3-[2-[(2-methoxy-2-methylpropyl)carbamoyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | COC(C)(C)CNC(=O)c1sccc1/C=C/C(=O)O |
| InChI | InChI=1S/C13H17NO4S/c1-13(2,18-3)8-14-12(17)11-9(6-7-19-11)4-5-10(15)16/h4-7H,8H2,1-3H3,(H,14,17)(H,15,16)/b5-4+ |
| InChIKey | XUJZLUBNQAYSAY-SNAWJCMRSA-N |
| XLogP | 2.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|