C10H9F2NO3S — CID 115408482
(E)-3-[2-(2,2-difluoroethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 115408482) has the molecular formula C10H9F2NO3S and a molecular weight of 261.25 g/mol. Its IUPAC name is (E)-3-[2-(2,2-difluoroethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(2,2-difluoroethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115408482 |
| Molecular Formula | C10H9F2NO3S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | (E)-3-[2-(2,2-difluoroethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccsc1C(=O)NCC(F)F |
| InChI | InChI=1S/C10H9F2NO3S/c11-7(12)5-13-10(16)9-6(3-4-17-9)1-2-8(14)15/h1-4,7H,5H2,(H,13,16)(H,14,15)/b2-1+ |
| InChIKey | MCXVAHNXAWFXEJ-OWOJBTEDSA-N |
| XLogP | 1.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|