C14H17NO3S2 — CID 80612372
(E)-3-[2-(thian-2-ylmethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 80612372) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (E)-3-[2-(thian-2-ylmethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(thian-2-ylmethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80612372 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (E)-3-[2-(thian-2-ylmethylcarbamoyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccsc1C(=O)NCC1CCCCS1 |
| InChI | InChI=1S/C14H17NO3S2/c16-12(17)5-4-10-6-8-20-13(10)14(18)15-9-11-3-1-2-7-19-11/h4-6,8,11H,1-3,7,9H2,(H,15,18)(H,16,17)/b5-4+ |
| InChIKey | PZCZVRGCKSAEMK-SNAWJCMRSA-N |
| XLogP | 2.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|