C11H15NO2S2 — CID 97064441
3-methoxy-N-[[(2R)-thiolan-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 97064441) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-methoxy-N-[[(2R)-thiolan-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 3-methoxy-N-[[(2R)-thiolan-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 97064441 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-methoxy-N-[[(2R)-thiolan-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | COc1ccsc1C(=O)NC[C@H]1CCCS1 |
| InChI | InChI=1S/C11H15NO2S2/c1-14-9-4-6-16-10(9)11(13)12-7-8-3-2-5-15-8/h4,6,8H,2-3,5,7H2,1H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | NVFWTWFEMXIOBK-MRVPVSSYSA-N |
| XLogP | 2.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |