C7H8N2O3S — CID 81128193
N-carbamoyl-3-methoxythiophene-2-carboxamide (PubChem CID 81128193) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is N-carbamoyl-3-methoxythiophene-2-carboxamide.
| Compound Name | N-carbamoyl-3-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 81128193 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | N-carbamoyl-3-methoxythiophene-2-carboxamide |
| SMILES | COc1ccsc1C(=O)NC(N)=O |
| InChI | InChI=1S/C7H8N2O3S/c1-12-4-2-3-13-5(4)6(10)9-7(8)11/h2-3H,1H3,(H3,8,9,10,11) |
| InChIKey | JYMHQXPDUDKEDV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |