C6H5ClN2O2S — CID 80642165
N-carbamoyl-3-chlorothiophene-2-carboxamide (PubChem CID 80642165) has the molecular formula C6H5ClN2O2S and a molecular weight of 204.64 g/mol. Its IUPAC name is N-carbamoyl-3-chlorothiophene-2-carboxamide.
| Compound Name | N-carbamoyl-3-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80642165 |
| Molecular Formula | C6H5ClN2O2S |
| Molecular Weight | 204.64 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | N-carbamoyl-3-chlorothiophene-2-carboxamide |
| SMILES | NC(=O)NC(=O)c1sccc1Cl |
| InChI | InChI=1S/C6H5ClN2O2S/c7-3-1-2-12-4(3)5(10)9-6(8)11/h1-2H,(H3,8,9,10,11) |
| InChIKey | RJLPYXBULJTQII-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.64 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |