C9H11ClN2OS2 — CID 80645165
N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-chlorothiophene-2-carboxamide (PubChem CID 80645165) has the molecular formula C9H11ClN2OS2 and a molecular weight of 262.79 g/mol. Its IUPAC name is N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-chlorothiophene-2-carboxamide.
| Compound Name | N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80645165 |
| Molecular Formula | C9H11ClN2OS2 |
| Molecular Weight | 262.79 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | N-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)-3-chlorothiophene-2-carboxamide |
| SMILES | CC(C)(NC(=O)c1sccc1Cl)C(N)=S |
| InChI | InChI=1S/C9H11ClN2OS2/c1-9(2,8(11)14)12-7(13)6-5(10)3-4-15-6/h3-4H,1-2H3,(H2,11,14)(H,12,13) |
| InChIKey | JRLPPQAYIUXZNC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|