C8H9ClN2OS2 — CID 80644124
N-(3-amino-3-sulfanylidenepropyl)-3-chlorothiophene-2-carboxamide (PubChem CID 80644124) has the molecular formula C8H9ClN2OS2 and a molecular weight of 248.76 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-chlorothiophene-2-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80644124 |
| Molecular Formula | C8H9ClN2OS2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-chlorothiophene-2-carboxamide |
| SMILES | NC(=S)CCNC(=O)c1sccc1Cl |
| InChI | InChI=1S/C8H9ClN2OS2/c9-5-2-4-14-7(5)8(12)11-3-1-6(10)13/h2,4H,1,3H2,(H2,10,13)(H,11,12) |
| InChIKey | GMTRWXSFLUFBER-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|