C10H12ClNO3S — CID 80645328
5-[(3-chlorothiophene-2-carbonyl)amino]pentanoic acid (PubChem CID 80645328) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is 5-[(3-chlorothiophene-2-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[(3-chlorothiophene-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 80645328 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 5-[(3-chlorothiophene-2-carbonyl)amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)c1sccc1Cl |
| InChI | InChI=1S/C10H12ClNO3S/c11-7-4-6-16-9(7)10(15)12-5-2-1-3-8(13)14/h4,6H,1-3,5H2,(H,12,15)(H,13,14) |
| InChIKey | HUYASYUOCAVKLJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|