C10H13Cl2NO2S — CID 106307128
3-chloro-N-[3-(2-chloroethoxy)propyl]thiophene-2-carboxamide (PubChem CID 106307128) has the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. Its IUPAC name is 3-chloro-N-[3-(2-chloroethoxy)propyl]thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-(2-chloroethoxy)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106307128 |
| Molecular Formula | C10H13Cl2NO2S |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 3-chloro-N-[3-(2-chloroethoxy)propyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCOCCCl)c1sccc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2S/c11-3-6-15-5-1-4-13-10(14)9-8(12)2-7-16-9/h2,7H,1,3-6H2,(H,13,14) |
| InChIKey | WVPKEWWSSVPNLN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|