C12H16ClNO4 — CID 106307093
N-[3-(2-chloroethoxy)propyl]-2,6-dihydroxybenzamide (PubChem CID 106307093) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is N-[3-(2-chloroethoxy)propyl]-2,6-dihydroxybenzamide.
| Compound Name | N-[3-(2-chloroethoxy)propyl]-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 106307093 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-[3-(2-chloroethoxy)propyl]-2,6-dihydroxybenzamide |
| SMILES | O=C(NCCCOCCCl)c1c(O)cccc1O |
| InChI | InChI=1S/C12H16ClNO4/c13-5-8-18-7-2-6-14-12(17)11-9(15)3-1-4-10(11)16/h1,3-4,15-16H,2,5-8H2,(H,14,17) |
| InChIKey | XVPJYGHZACDJNA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|