C14H20ClNO2 — CID 114171364
N-[3-(2-chloroethoxy)propyl]-2,6-dimethylbenzamide (PubChem CID 114171364) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is N-[3-(2-chloroethoxy)propyl]-2,6-dimethylbenzamide.
| Compound Name | N-[3-(2-chloroethoxy)propyl]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 114171364 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[3-(2-chloroethoxy)propyl]-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NCCCOCCCl |
| InChI | InChI=1S/C14H20ClNO2/c1-11-5-3-6-12(2)13(11)14(17)16-8-4-9-18-10-7-15/h3,5-6H,4,7-10H2,1-2H3,(H,16,17) |
| InChIKey | DFPMDRPNZAWKCJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|