C11H12F3NO4 — CID 103890229
2,6-dihydroxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide (PubChem CID 103890229) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2,6-dihydroxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide.
| Compound Name | 2,6-dihydroxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 103890229 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2,6-dihydroxy-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
| SMILES | O=C(NCCOCC(F)(F)F)c1c(O)cccc1O |
| InChI | InChI=1S/C11H12F3NO4/c12-11(13,14)6-19-5-4-15-10(18)9-7(16)2-1-3-8(9)17/h1-3,16-17H,4-6H2,(H,15,18) |
| InChIKey | WCDVYQTYGWIXML-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|