C13H17NO4 — CID 103890690
N-(2-but-3-enoxyethyl)-2,6-dihydroxybenzamide (PubChem CID 103890690) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-2,6-dihydroxybenzamide.
| Compound Name | N-(2-but-3-enoxyethyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 103890690 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-2,6-dihydroxybenzamide |
| SMILES | C=CCCOCCNC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C13H17NO4/c1-2-3-8-18-9-7-14-13(17)12-10(15)5-4-6-11(12)16/h2,4-6,15-16H,1,3,7-9H2,(H,14,17) |
| InChIKey | VZSJCWQJRDRXCH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|