C10H15N3O2 — CID 103855622
N-(2-but-3-enoxyethyl)-1H-pyrazole-4-carboxamide (PubChem CID 103855622) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-but-3-enoxyethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 103855622 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-1H-pyrazole-4-carboxamide |
| SMILES | C=CCCOCCNC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H15N3O2/c1-2-3-5-15-6-4-11-10(14)9-7-12-13-8-9/h2,7-8H,1,3-6H2,(H,11,14)(H,12,13) |
| InChIKey | WCFYXEQANWSYBG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|