C8H11N3O4 — CID 79469118
2-[2-(1H-pyrazole-4-carbonylamino)ethoxy]acetic acid (PubChem CID 79469118) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-[2-(1H-pyrazole-4-carbonylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(1H-pyrazole-4-carbonylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79469118 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-[2-(1H-pyrazole-4-carbonylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C8H11N3O4/c12-7(13)5-15-2-1-9-8(14)6-3-10-11-4-6/h3-4H,1-2,5H2,(H,9,14)(H,10,11)(H,12,13) |
| InChIKey | JGBFNVMYTCLYMD-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|