C12H17N3O5S — CID 170283260
2-[2-[2-[(2-methylsulfanylpyrimidine-5-carbonyl)amino]ethoxy]ethoxy]acetic acid (PubChem CID 170283260) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[2-[2-[(2-methylsulfanylpyrimidine-5-carbonyl)amino]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[(2-methylsulfanylpyrimidine-5-carbonyl)amino]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 170283260 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[2-[2-[(2-methylsulfanylpyrimidine-5-carbonyl)amino]ethoxy]ethoxy]acetic acid |
| SMILES | CSc1ncc(C(=O)NCCOCCOCC(=O)O)cn1 |
| InChI | InChI=1S/C12H17N3O5S/c1-21-12-14-6-9(7-15-12)11(18)13-2-3-19-4-5-20-8-10(16)17/h6-7H,2-5,8H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | IHQHPOCHYOKDGS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|