C27H43N3O11 — CID 135135629
2-[2-[2-[2-[2-[[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 135135629) has the molecular formula C27H43N3O11 and a molecular weight of 585.65 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-[[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 135135629 |
| Molecular Formula | C27H43N3O11 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 2-[2-[2-[2-[2-[[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)OC(C)(C)C)cc(C(=O)NCCOCCOCCOCCOCC(=O)O)c1 |
| InChI | InChI=1S/C27H43N3O11/c1-26(2,3)40-24(34)29-20-15-19(16-21(17-20)30-25(35)41-27(4,5)6)23(33)28-7-8-36-9-10-37-11-12-38-13-14-39-18-22(31)32/h15-17H,7-14,18H2,1-6H3,(H,28,33)(H,29,34)(H,30,35)(H,31,32) |
| InChIKey | WYGRQAUMYQNIOP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 179.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|