C42H69N3O15 — CID 57103307
tert-butyl 3-[2-[2-[[3,5-bis[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]ethoxy]ethoxy]propanoate (PubChem CID 57103307) has the molecular formula C42H69N3O15 and a molecular weight of 856.02 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[[3,5-bis[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[[3,5-bis[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 57103307 |
| Molecular Formula | C42H69N3O15 |
| Molecular Weight | 856.02 g/mol |
| Exact Mass | 855.47 |
| IUPAC Name | tert-butyl 3-[2-[2-[[3,5-bis[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNC(=O)c1cc(C(=O)NCCOCCOCCC(=O)OC(C)(C)C)cc(C(=O)NCCOCCOCCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C42H69N3O15/c1-40(2,3)58-34(46)10-16-52-22-25-55-19-13-43-37(49)31-28-32(38(50)44-14-20-56-26-23-53-17-11-35(47)59-41(4,5)6)30-33(29-31)39(51)45-15-21-57-27-24-54-18-12-36(48)60-42(7,8)9/h28-30H,10-27H2,1-9H3,(H,43,49)(H,44,50)(H,45,51) |
| InChIKey | SAJCYXOUHCTVBK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 221.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.02 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|