C25H37N3O9 — CID 172604144
tert-butyl 3-[2-[2-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 172604144) has the molecular formula C25H37N3O9 and a molecular weight of 523.58 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 172604144 |
| Molecular Formula | C25H37N3O9 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | COc1ccc(C(=O)NCCOCCOCCOCCC(=O)OC(C)(C)C)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H37N3O9/c1-25(2,3)37-22(30)8-11-34-13-15-36-16-14-35-12-9-26-23(31)18-5-6-20(33-4)19(17-18)28-10-7-21(29)27-24(28)32/h5-6,17H,7-16H2,1-4H3,(H,26,31)(H,27,29,32) |
| InChIKey | JAQSMPNFVADZTD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|