C17H22N4O4 — CID 172604568
3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxy-N-piperidin-4-ylbenzamide (PubChem CID 172604568) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxy-N-piperidin-4-ylbenzamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxy-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 172604568 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxy-N-piperidin-4-ylbenzamide |
| SMILES | COc1ccc(C(=O)NC2CCNCC2)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H22N4O4/c1-25-14-3-2-11(16(23)19-12-4-7-18-8-5-12)10-13(14)21-9-6-15(22)20-17(21)24/h2-3,10,12,18H,4-9H2,1H3,(H,19,23)(H,20,22,24) |
| InChIKey | GLXQVGDOVIDHON-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |