C15H20N4O3 — CID 167463577
1-(2-methoxy-5-piperazin-1-ylphenyl)-1,3-diazinane-2,4-dione (PubChem CID 167463577) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(2-methoxy-5-piperazin-1-ylphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2-methoxy-5-piperazin-1-ylphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167463577 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-(2-methoxy-5-piperazin-1-ylphenyl)-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(N2CCNCC2)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H20N4O3/c1-22-13-3-2-11(18-8-5-16-6-9-18)10-12(13)19-7-4-14(20)17-15(19)21/h2-3,10,16H,4-9H2,1H3,(H,17,20,21) |
| InChIKey | UFCWUIVYFAFVGM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|