C12H20Cl2N2O2 — CID 22625407
1-(3,4-dimethoxyphenyl)piperazine;dihydrochloride (PubChem CID 22625407) has the molecular formula C12H20Cl2N2O2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)piperazine;dihydrochloride.
| Compound Name | 1-(3,4-dimethoxyphenyl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 22625407 |
| Molecular Formula | C12H20Cl2N2O2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)piperazine;dihydrochloride |
| SMILES | COc1ccc(N2CCNCC2)cc1OC.Cl.Cl |
| InChI | InChI=1S/C12H18N2O2.2ClH/c1-15-11-4-3-10(9-12(11)16-2)14-7-5-13-6-8-14;;/h3-4,9,13H,5-8H2,1-2H3;2*1H |
| InChIKey | WNPZHRFAICTMIH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|