C13H21BrN2O3 — CID 12899422
1-(3,4,5-trimethoxyphenyl)piperazine;hydrobromide (PubChem CID 12899422) has the molecular formula C13H21BrN2O3 and a molecular weight of 333.23 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)piperazine;hydrobromide.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)piperazine;hydrobromide |
|---|---|
| PubChem CID | 12899422 |
| Molecular Formula | C13H21BrN2O3 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)piperazine;hydrobromide |
| SMILES | Br.COc1cc(N2CCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C13H20N2O3.BrH/c1-16-11-8-10(15-6-4-14-5-7-15)9-12(17-2)13(11)18-3;/h8-9,14H,4-7H2,1-3H3;1H |
| InChIKey | NWMYZJOAUNJTAN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|