C13H20F2N2O — CID 145414301
1-(3,4-difluoro-5-methoxyphenyl)piperazine;ethane (PubChem CID 145414301) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-(3,4-difluoro-5-methoxyphenyl)piperazine;ethane.
| Compound Name | 1-(3,4-difluoro-5-methoxyphenyl)piperazine;ethane |
|---|---|
| PubChem CID | 145414301 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-(3,4-difluoro-5-methoxyphenyl)piperazine;ethane |
| SMILES | CC.COc1cc(N2CCNCC2)cc(F)c1F |
| InChI | InChI=1S/C11H14F2N2O.C2H6/c1-16-10-7-8(6-9(12)11(10)13)15-4-2-14-3-5-15;1-2/h6-7,14H,2-5H2,1H3;1-2H3 |
| InChIKey | DKEWFOSGIPEBOL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |