C11H11F5N2 — CID 176727239
1-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperazine (PubChem CID 176727239) has the molecular formula C11H11F5N2 and a molecular weight of 266.21 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 176727239 |
| Molecular Formula | C11H11F5N2 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-[3,5-difluoro-4-(trifluoromethyl)phenyl]piperazine |
| SMILES | Fc1cc(N2CCNCC2)cc(F)c1C(F)(F)F |
| InChI | InChI=1S/C11H11F5N2/c12-8-5-7(18-3-1-17-2-4-18)6-9(13)10(8)11(14,15)16/h5-6,17H,1-4H2 |
| InChIKey | IXIHLIBANCQMFJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |