C10H14Cl2F3N3 — CID 154825576
1-[2-(trifluoromethyl)-4-pyridinyl]piperazine;dihydrochloride (PubChem CID 154825576) has the molecular formula C10H14Cl2F3N3 and a molecular weight of 304.14 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-4-pyridinyl]piperazine;dihydrochloride.
| Compound Name | 1-[2-(trifluoromethyl)-4-pyridinyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 154825576 |
| Molecular Formula | C10H14Cl2F3N3 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-[2-(trifluoromethyl)-4-pyridinyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1cc(N2CCNCC2)ccn1 |
| InChI | InChI=1S/C10H12F3N3.2ClH/c11-10(12,13)9-7-8(1-2-15-9)16-5-3-14-4-6-16;;/h1-2,7,14H,3-6H2;2*1H |
| InChIKey | HPEYLDIQBMOAAY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |