C16H21F3N2 — CID 91080290
3-methyl-8-[2-(trifluoromethyl)-4-pyridinyl]-8-azaspiro[4.5]decane (PubChem CID 91080290) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-methyl-8-[2-(trifluoromethyl)-4-pyridinyl]-8-azaspiro[4.5]decane.
| Compound Name | 3-methyl-8-[2-(trifluoromethyl)-4-pyridinyl]-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 91080290 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-methyl-8-[2-(trifluoromethyl)-4-pyridinyl]-8-azaspiro[4.5]decane |
| SMILES | CC1CCC2(CCN(c3ccnc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C16H21F3N2/c1-12-2-4-15(11-12)5-8-21(9-6-15)13-3-7-20-14(10-13)16(17,18)19/h3,7,10,12H,2,4-6,8-9,11H2,1H3 |
| InChIKey | HQVBQZJDICLJFW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |