C11H13ClF3N3 — CID 118054993
N-chloro-1-[2-(trifluoromethyl)-4-pyridinyl]piperidin-4-amine (PubChem CID 118054993) has the molecular formula C11H13ClF3N3 and a molecular weight of 279.69 g/mol. Its IUPAC name is N-chloro-1-[2-(trifluoromethyl)-4-pyridinyl]piperidin-4-amine.
| Compound Name | N-chloro-1-[2-(trifluoromethyl)-4-pyridinyl]piperidin-4-amine |
|---|---|
| PubChem CID | 118054993 |
| Molecular Formula | C11H13ClF3N3 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-chloro-1-[2-(trifluoromethyl)-4-pyridinyl]piperidin-4-amine |
| SMILES | FC(F)(F)c1cc(N2CCC(NCl)CC2)ccn1 |
| InChI | InChI=1S/C11H13ClF3N3/c12-17-8-2-5-18(6-3-8)9-1-4-16-10(7-9)11(13,14)15/h1,4,7-8,17H,2-3,5-6H2 |
| InChIKey | RCNBAWXWKRXBEB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|