C15H20F3N3O2 — CID 155168237
tert-butyl-[1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 155168237) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is tert-butyl-[1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 155168237 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | tert-butyl-[1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCN(c2ccnc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H20F3N3O2/c1-14(2,3)21(13(22)23)11-5-7-20(9-11)10-4-6-19-12(8-10)15(16,17)18/h4,6,8,11H,5,7,9H2,1-3H3,(H,22,23) |
| InChIKey | REILTYBBOFHEFM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |