C19H26F3N3NaO2 — CID 160639767
CID 160639767 (PubChem CID 160639767) has the molecular formula C19H26F3N3NaO2 and a molecular weight of 408.42 g/mol.
| Compound Name | CID 160639767 |
|---|---|
| PubChem CID | 160639767 |
| Molecular Formula | C19H26F3N3NaO2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCN(c3ccnc(C(F)(F)F)c3)CC2)C1.[Na] |
| InChI | InChI=1S/C19H26F3N3O2.Na/c1-17(2,3)27-16(26)25-11-7-18(13-25)5-9-24(10-6-18)14-4-8-23-15(12-14)19(20,21)22;/h4,8,12H,5-7,9-11,13H2,1-3H3; |
| InChIKey | RJADSDGFONHBCR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |