C10H11ClF2N2 — CID 84795776
1-(4-chloro-3,5-difluorophenyl)piperazine (PubChem CID 84795776) has the molecular formula C10H11ClF2N2 and a molecular weight of 232.66 g/mol. Its IUPAC name is 1-(4-chloro-3,5-difluorophenyl)piperazine.
| Compound Name | 1-(4-chloro-3,5-difluorophenyl)piperazine |
|---|---|
| PubChem CID | 84795776 |
| Molecular Formula | C10H11ClF2N2 |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1-(4-chloro-3,5-difluorophenyl)piperazine |
| SMILES | Fc1cc(N2CCNCC2)cc(F)c1Cl |
| InChI | InChI=1S/C10H11ClF2N2/c11-10-8(12)5-7(6-9(10)13)15-3-1-14-2-4-15/h5-6,14H,1-4H2 |
| InChIKey | HEZUSVOMEYMXIM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|