C10H12Br2N2 — CID 21331858
1-(3,5-dibromophenyl)piperazine (PubChem CID 21331858) has the molecular formula C10H12Br2N2 and a molecular weight of 320.03 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)piperazine.
| Compound Name | 1-(3,5-dibromophenyl)piperazine |
|---|---|
| PubChem CID | 21331858 |
| Molecular Formula | C10H12Br2N2 |
| Molecular Weight | 320.03 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | 1-(3,5-dibromophenyl)piperazine |
| SMILES | Brc1cc(Br)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C10H12Br2N2/c11-8-5-9(12)7-10(6-8)14-3-1-13-2-4-14/h5-7,13H,1-4H2 |
| InChIKey | LBCMQRUBXURELD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.03 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |