C12H16Br2N2 — CID 165455601
1-(3,5-dibromophenyl)-5-methyl-1,4-diazepane (PubChem CID 165455601) has the molecular formula C12H16Br2N2 and a molecular weight of 348.08 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-5-methyl-1,4-diazepane.
| Compound Name | 1-(3,5-dibromophenyl)-5-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 165455601 |
| Molecular Formula | C12H16Br2N2 |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 1-(3,5-dibromophenyl)-5-methyl-1,4-diazepane |
| SMILES | CC1CCN(c2cc(Br)cc(Br)c2)CCN1 |
| InChI | InChI=1S/C12H16Br2N2/c1-9-2-4-16(5-3-15-9)12-7-10(13)6-11(14)8-12/h6-9,15H,2-5H2,1H3 |
| InChIKey | VMFJOIAAKIZCHV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |