C11H16BrN3 — CID 96944496
(3S)-1-(5-bromo-3-methyl-2-pyridinyl)-3-methylpiperazine (PubChem CID 96944496) has the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. Its IUPAC name is (3S)-1-(5-bromo-3-methyl-2-pyridinyl)-3-methylpiperazine.
| Compound Name | (3S)-1-(5-bromo-3-methyl-2-pyridinyl)-3-methylpiperazine |
|---|---|
| PubChem CID | 96944496 |
| Molecular Formula | C11H16BrN3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (3S)-1-(5-bromo-3-methyl-2-pyridinyl)-3-methylpiperazine |
| SMILES | Cc1cc(Br)cnc1N1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C11H16BrN3/c1-8-5-10(12)6-14-11(8)15-4-3-13-9(2)7-15/h5-6,9,13H,3-4,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | NTAWUWNRRZNQRL-VIFPVBQESA-N |
| XLogP | 1.95 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |