C13H19BrN4 — CID 79718223
1-(azetidin-3-yl)-4-(5-bromo-3-methyl-2-pyridinyl)piperazine (PubChem CID 79718223) has the molecular formula C13H19BrN4 and a molecular weight of 311.23 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(5-bromo-3-methyl-2-pyridinyl)piperazine.
| Compound Name | 1-(azetidin-3-yl)-4-(5-bromo-3-methyl-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 79718223 |
| Molecular Formula | C13H19BrN4 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(5-bromo-3-methyl-2-pyridinyl)piperazine |
| SMILES | Cc1cc(Br)cnc1N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C13H19BrN4/c1-10-6-11(14)7-16-13(10)18-4-2-17(3-5-18)12-8-15-9-12/h6-7,12,15H,2-5,8-9H2,1H3 |
| InChIKey | GZHKRYDGMFKPSW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |